CAS 123843-65-2

2,6-Difluoro-4-methoxybenzoic acid

Description:

2,6-Difluoro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group on a benzoic acid framework. The fluorine substituents are located at the 2 and 6 positions of the benzene ring, while the methoxy group is positioned at the 4 position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure contributes to its unique chemical properties, including potential applications in pharmaceuticals and agrochemicals. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it a valuable candidate in drug design. Additionally, the methoxy group can influence the compound's reactivity and interaction with biological targets. As with many benzoic acid derivatives, it may exhibit acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₈H₆F₂O₃

InChI: InChI=1S/C8H6F2O3/c1-13-4-2-5(9)7(8(11)12)6(10)3-4/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=LGHVYSAINQRZJQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C=C(OC)C=C1F

Synonyms:

• 2,6-Difluoro-4-methoxybenzoic acid
• Benzoic acid, 2,6-difluoro-4-methoxy-

Benzoic acid, 2,6-difluoro-4-methoxy-

CAS: 123843-65-2

Formula: C₈H₆F₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1282

Ref: IN-DA000L5T

2,6-Difluoro-4-methoxybenzoic acid

CAS: 123843-65-2

2,6-Difluoro-4-methoxybenzoic acid

Formula: C₈H₆F₂O₃

Purity: 97%

Color and Shape: Pale Yellow Solid

Molecular weight: 188.13g/mol

Ref: 54-PC2383

2,6-Difluoro-4-methoxybenzoic acid

CAS: 123843-65-2

Formula: C₈H₆F₂O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 188.13

Ref: 10-F046413