CAS 123843-67-4
:4-Bromo-2,6-difluorobenzonitrile
Description:
4-Bromo-2,6-difluorobenzonitrile is an aromatic compound characterized by the presence of a bromine atom and two fluorine atoms attached to a benzene ring, along with a nitrile functional group (-C≡N). This compound features a substituted benzene structure, which contributes to its chemical stability and reactivity. The presence of electronegative halogens, such as bromine and fluorine, influences its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The nitrile group imparts additional polarity and can participate in hydrogen bonding, affecting its solubility in polar solvents. 4-Bromo-2,6-difluorobenzonitrile is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of halogen substituents can also enhance its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H2BrF2N
InChI:InChI=1S/C7H2BrF2N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H
InChI key:InChIKey=TZHQWUAOIWRFSW-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)C=C(Br)C=C1F
Synonyms:- 2,6-Difluoro-4-Bromobenzonitrile
- Benzonitrile, 4-bromo-2,6-difluoro-
- 4-Bromo-2,6-difluorobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-2,6-difluorobenzonitrile
CAS:Formula:C7H2BrF2NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:218.00Benzonitrile, 4-bromo-2,6-difluoro-
CAS:Formula:C7H2BrF2NPurity:97%Color and Shape:SolidMolecular weight:217.99834-Bromo-2,6-difluorobenzonitrile
CAS:4-Bromo-2,6-difluorobenzonitrileFormula:C7H2BrF2NPurity:≥95%Color and Shape: faint cream. crystalline solidMolecular weight:218.00g/mol4-Bromo-2,6-difluorobenzonitrile
CAS:4-Bromo-2,6-difluorobenzonitrile is a chemical that can be synthesized from tetrahydrofuran and benzonitrile. It has been shown to have photophysical properties. This chemical has been used as a precursor for the synthesis of other compounds. 4-Bromo-2,6-difluorobenzonitrile has also been used in the production of methanoic acid and cyclohexane ring fragments. The reaction conditions are refluxed in cyclohexane with activated tetrakistriphenylphosphine to form the corresponding Grignard reagent. This is then thermally reduced butoxide to give the desired product.Formula:C7H2BrF2NPurity:Min. 95%Color and Shape:PowderMolecular weight:218 g/mol4-Bromo-2,6-difluorobenzonitrile
CAS:Formula:C7H2BrF2NPurity:97%Color and Shape:SolidMolecular weight:218.0014-Bromo-2,6-difluorobenzonitrile
CAS:Controlled ProductApplications 4-Bromo-2,6-difluorobenzonitrile
Formula:C7H2BrF2NColor and Shape:NeatMolecular weight:218.0





