CAS 123846-67-3
:3-Methyl-5-nitro-2-pyridineacetonitrile
Description:
3-Methyl-5-nitro-2-pyridineacetonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methyl group and a nitro group attached to the pyridine ring, contributing to its chemical reactivity and properties. The presence of the acetonitrile functional group indicates that it contains a cyano group (-C≡N) linked to an acetyl moiety, which can influence its polarity and solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic substitution reactions. Additionally, the methyl group can provide steric hindrance, influencing the compound's behavior in chemical reactions. Overall, 3-Methyl-5-nitro-2-pyridineacetonitrile is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as an intermediate in the production of more complex molecules.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-6-4-7(11(12)13)5-10-8(6)2-3-9/h4-5H,2H2,1H3
InChI key:InChIKey=ZLJHIKPSNBXLBU-UHFFFAOYSA-N
SMILES:C(C#N)C1=C(C)C=C(N(=O)=O)C=N1
Synonyms:- 2-Pyridineacetonitrile, 3-methyl-5-nitro-
- 3-Methyl-5-nitro-2-pyridineacetonitrile
- 2-(3-Methyl-5-nitropyridin-2-yl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
