CAS 123848-64-6
:4-Amino-2-(methylamino)benzenesulfonic acid
Description:
4-Amino-2-(methylamino)benzenesulfonic acid, also known as a derivative of sulfanilic acid, is an organic compound characterized by the presence of both amino and sulfonic acid functional groups. This compound typically appears as a crystalline solid and is soluble in water due to the sulfonic acid group, which enhances its hydrophilicity. The presence of amino groups contributes to its basicity and potential reactivity in various chemical reactions, including coupling reactions in dye synthesis. It is often used in biochemical applications, particularly in the synthesis of azo dyes and as a reagent in analytical chemistry. The compound's structure includes a benzene ring substituted with an amino group and a sulfonic acid group, which can influence its acidity and overall reactivity. Safety data should be consulted for handling, as with many chemical substances, it may pose health risks if not managed properly. Overall, 4-Amino-2-(methylamino)benzenesulfonic acid is a versatile compound with applications in both industrial and laboratory settings.
Formula:C7H10N2O3S
InChI:InChI=1S/C7H10N2O3S/c1-9-6-4-5(8)2-3-7(6)13(10,11)12/h2-4,9H,8H2,1H3,(H,10,11,12)
InChI key:InChIKey=VXAOMQMMCGVYOO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(NC)C=C(N)C=C1
Synonyms:- Benzenesulfonic acid, 4-amino-2-(methylamino)-
- 4-Amino-2-methylamino-1-benzenesulfonic acid
- 1-Amino-3-(methylamino)-4-benzenesulfonic acid
- 4-Amino-2-(methylamino)benzenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
