CAS 123875-01-4: 2-phenylsulfanylethyl methyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-d icarboxylate
Description:2-Phenylsulfanylethyl methyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate is a complex organic compound characterized by its unique structural features, including a dihydropyridine core and multiple functional groups. This compound typically exhibits properties associated with dihydropyridines, such as potential biological activity, particularly in relation to calcium channel modulation. The presence of the phenylsulfanyl group may enhance lipophilicity, influencing its solubility and interaction with biological membranes. Additionally, the methyl and carboxylate groups contribute to its reactivity and potential for forming hydrogen bonds. The compound's molecular structure suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their pharmacological properties. As with many organic compounds, stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C19H23NO4S
InChI:InChI=1/C19H23NO4S/c1-12-16(18(21)23-4)13(2)20-14(3)17(12)19(22)24-10-11-25-15-8-6-5-7-9-15/h5-9,12,20H,10-11H2,1-4H3
- Synonyms:
- Pca 4248
- 2-(Phenylthio)ethyl-5-methoxycarbonyl-2,4,6-trimethyl-1,4-dihydropyridine-3-carboxylate
- 3-(2-(Phenylthio)ethyl)-5-methoxycarbonyl-4-methyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate
- Ptemc
- 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,4,6-trimethyl-, methyl 2-(phenylthio)ethyl ester
- Methyl 2-(Phenylsulfanyl)Ethyl 2,4,6-Trimethyl-1,4-Dihydropyridine-3,5-Dicarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,4,6-trimethyl-, 3-methyl 5-[2-(phenylthio)ethyl] ester REF: IN-DA000L7ACAS: 123875-01-4 | - - - | To inquire | Mon 07 Apr 25 |
![]() | PCA 4248 REF: TM-T23123CAS: 123875-01-4 | 98% | 907.00 €~2,375.00 € | Tue 27 May 25 |

3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,4,6-trimethyl-, 3-methyl 5-[2-(phenylthio)ethyl] ester
Ref: IN-DA000L7A
Undefined size | To inquire |

PCA 4248
Ref: TM-T23123
25mg | 1,444.00 € | ||
50mg | 1,882.00 € | ||
100mg | 2,375.00 € |