CAS 123875-21-8

3-Chloro-5H-[1]benzopyrano[4,3-c]pyridazine

Description:

3-Chloro-5H-[1]benzopyrano[4,3-c]pyridazine is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both benzopyrano and pyridazine moieties. This compound features a chlorine substituent at the 3-position, which can influence its reactivity and solubility. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the specific functional groups and their arrangement within the molecule. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining the compound's reactivity and interactions with biological targets. Further studies would be necessary to elucidate its specific applications and biological activities.

Formula: C₁₁H₇ClN₂O

InChI: InChI=1S/C11H7ClN2O/c12-10-5-7-6-15-9-4-2-1-3-8(9)11(7)14-13-10/h1-5H,6H2

InChI key: InChIKey=CTTAKIWDRFXVBY-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(C=3C(OC2)=CC=CC3)=NN1

Synonyms:

• 5H-[1]Benzopyrano[4,3-c]pyridazine, 3-chloro-
• 3-Chloro-5H-[1]benzopyrano[4,3-c]pyridazine
• 3-Chloro-5H-chromeno[4,3-c]pyridazine

3-Chloro-5H-chromeno[4,3-c]pyridazine

CAS: 123875-21-8

Versatile small molecule scaffold

Formula: C₁₁H₇ClN₂O

Purity: Min. 95%

Molecular weight: 218.64 g/mol

Ref: 3D-YEA87521