CymitQuimica logo

CAS 123875-23-0

:

2H-[1]Benzothiopyrano[4,3-c]pyridazin-3(5H)-one

Description:
2H-[1]Benzothiopyrano[4,3-c]pyridazin-3(5H)-one is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both benzothiophene and pyridazine moieties. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and the ability to participate in various chemical reactions. Its structure suggests the presence of multiple functional groups, which may contribute to its reactivity and solubility in different solvents. The compound may also display interesting optical properties due to its conjugated system. Additionally, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to the presence of the pyridazine ring, which is often associated with bioactive compounds. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to chemical databases for precise values. Overall, 2H-[1]Benzothiopyrano[4,3-c]pyridazin-3(5H)-one is a compound of interest in the field of organic chemistry and drug development.
Formula:C11H8N2OS
InChI:InChI=1S/C11H8N2OS/c14-10-5-7-6-15-9-4-2-1-3-8(9)11(7)13-12-10/h1-5H,6H2,(H,12,14)
InChI key:InChIKey=SPDFCDUCLRSDFJ-UHFFFAOYSA-N
SMILES:O=C1C=C2C(C=3C(SC2)=CC=CC3)=NN1
Synonyms:
  • 2H-[1]Benzothiopyrano[4,3-c]pyridazin-3(5H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.