CAS 123892-57-9

7-Methyl-1-[(4-methylphenyl)sulfonyl]-1H-indole

Description:

7-Methyl-1-[(4-methylphenyl)sulfonyl]-1H-indole, identified by its CAS number 123892-57-9, is a chemical compound that belongs to the indole class of compounds, which are characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This particular compound features a methyl group at the 7-position of the indole ring and a sulfonyl group attached to a para-methylphenyl moiety, contributing to its unique chemical properties. The presence of the sulfonyl group enhances its reactivity and solubility in various solvents, making it useful in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in the fields of oncology or neurology, due to the structural motifs common in bioactive molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. As with many indole derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks.

Formula: C₁₆H₁₅NO₂S

InChI: InChI=1S/C16H15NO2S/c1-12-6-8-15(9-7-12)20(18,19)17-11-10-14-5-3-4-13(2)16(14)17/h3-11H,1-2H3

InChI key: InChIKey=NBJBSZXTULZDES-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C=C1)=CC=CC2C)C3=CC=C(C)C=C3

Synonyms:

• 7-Methyl-1-[(4-methylphenyl)sulfonyl]-1H-indole
• 1H-Indole, 7-methyl-1-[(4-methylphenyl)sulfonyl]-

1H-Indole, 7-methyl-1-[(4-methylphenyl)sulfonyl]-

CAS: 123892-57-9

Formula: C₁₆H₁₅NO₂S

Molecular weight: 285.3608

Ref: IN-DA000L83