CAS 123895-42-1
:2-(BROMOMETHYL)-5-(TRIFLUOROMETHYL) BENZOTHIAZOLE
Description:
2-(Bromomethyl)-5-(trifluoromethyl)benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole ring substituted with a bromomethyl group and a trifluoromethyl group. The presence of the bromomethyl group introduces a reactive site that can participate in various chemical reactions, making it useful in synthetic organic chemistry. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, often imparting properties such as increased metabolic stability and altered pharmacokinetics. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science. Its properties, such as solubility, melting point, and reactivity, can vary based on the solvent and conditions used in experiments. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and fluorine atoms, which can be toxic or hazardous under certain conditions.
Formula:C9H5BrF3NS
InChI:InChI=1/C9H5BrF3NS/c10-4-8-14-6-3-5(9(11,12)13)1-2-7(6)15-8/h1-3H,4H2
SMILES:c1cc2c(cc1C(F)(F)F)nc(CBr)s2
Synonyms:- 2-(Bromomethyl)-5-(Trifluoromethyl)-1,3-Benzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
