CAS 1239034-70-8

4-(2-Methyl-l,2^,4-tetrahydro-pyrido[4,3-6]indol-5-ylmethyl)beiizoic acid methyl ester

Description:

4-(2-Methyl-1,2,4-tetrahydro-pyrido[4,3-b]indol-5-ylmethyl)benzoic acid methyl ester, with the CAS number 1239034-70-8, is a complex organic compound characterized by its unique structural features. It contains a benzoic acid moiety esterified with a methyl group, which contributes to its solubility and reactivity. The presence of a tetrahydropyridoindole structure suggests potential biological activity, as such frameworks are often associated with pharmacological properties. This compound may exhibit characteristics typical of indole derivatives, including potential interactions with biological targets due to its nitrogen-containing heterocyclic structure. Its molecular configuration likely influences its physical properties, such as melting point, boiling point, and solubility in various solvents. Additionally, the compound may participate in various chemical reactions, including esterification and nucleophilic substitutions, making it of interest in synthetic organic chemistry and medicinal chemistry research. Further studies would be necessary to elucidate its specific applications and biological activities.

Formula: C₂₁H₂₂N₂O₂

InChI: InChI=1S/C21H22N2O2/c1-22-12-11-20-18(14-22)17-5-3-4-6-19(17)23(20)13-15-7-9-16(10-8-15)21(24)25-2/h3-10H,11-14H2,1-2H3

InChI key: RMAYYLGDIMEEOS-UHFFFAOYSA-N

SMILES: CN1CCC2=C(C1)C3=CC=CC=C3N2CC4=CC=C(C=C4)C(=O)OC

Synonyms:

• 4-(2-Methyl-l,2^,4-tetrahydro-pyrido[4,3-6]indol-
• Methyl 4-((2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5(2H)-yl)methyl)benzoate
• 4-(2-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-ylmethyl)benzoic acid methyl ester
• 4-(2-Methyl-l,2^,4-tetrahydro-pyrido[4,3-6]indol-5-ylmethyl)beiizoic acid methyl ester
• Benzoic acid, 4-[(1,2,3,4-tetrahydro-2-methyl-5H-pyrido[4,3-b]indol-5-yl)methyl]-, methyl ester

Tubastatin

CAS: 1239034-70-8

Tubastatin

Formula: C₂₁H₂₂N₂O₂

Purity: ≥95%

Molecular weight: 334.41

Ref: 54-BUP03837

Tubastatin

CAS: 1239034-70-8

Tubastatin inhibits TGF-β1-induced S6K phosphorylation, HIF-1α expression and VEG F expression.

Formula: C₂₁H₂₂N₂O₂

Purity: 98.43%

Color and Shape: Solid

Molecular weight: 334.4116

Ref: TM-T29023

Tubastatin

CAS: 1239034-70-8

Methyl 4-((2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5(2H)-yl)methyl)benzoate

Formula: C₂₁H₂₂N₂O₂

Purity: 97%

Molecular weight: 334.41

Ref: IN-DG764248