CymitQuimica logo

CAS 123916-70-1

:

(7S,8S,11R,13S,14S,17R)-11-[4-(dimethylamino)phenyl]-7,13-dimethyl-1,4',5',6,7,8,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3(2H)-one

Description:
The chemical substance with the name "(7S,8S,11R,13S,14S,17R)-11-[4-(dimethylamino)phenyl]-7,13-dimethyl-1,4',5',6,7,8,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3(2H)-one" and CAS number "123916-70-1" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a spirocyclic framework, which contributes to its unique three-dimensional shape and potential biological activity. The presence of a dimethylamino group suggests that it may exhibit basic properties and could interact with biological targets, potentially influencing its pharmacological profile. The compound's dodecahydro structure indicates a high degree of saturation, which may affect its reactivity and stability. Additionally, the specific stereochemical configuration (indicated by the S and R designations) is crucial for determining the compound's interactions with enzymes and receptors, influencing its efficacy and safety in biological systems. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry and drug development.
Formula:C30H39NO2
InChI:InChI=1/C30H39NO2/c1-19-16-21-17-23(32)10-11-24(21)28-25(20-6-8-22(9-7-20)31(3)4)18-29(2)26(27(19)28)12-14-30(29)13-5-15-33-30/h6-9,17,19,25-27H,5,10-16,18H2,1-4H3/t19-,25+,26-,27-,29-,30-/m0/s1
Synonyms:
  • Spiro(estra-4,9-diene-17,2'(3'H)-furan)-3-one, 11-(4-(dimethylamino)phenyl)-4',5'-dihydro-7-methyl-, (7beta,11beta,17beta)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.