CymitQuimica logo

CAS 123926-66-9

:

N-[1-(3’-Benzyloxyphenyl)ethyl]-N-methylamine

Description:
N-[1-(3’-Benzyloxyphenyl)ethyl]-N-methylamine, with the CAS number 123926-66-9, is an organic compound characterized by its amine functional group, which features a nitrogen atom bonded to both a methyl group and a phenethyl moiety. The presence of the benzyloxy group indicates that the compound has a phenolic structure, contributing to its potential reactivity and solubility properties. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its interactions in biological systems or chemical reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aromatic rings that can enhance biological activity. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it a versatile candidate for further research in organic synthesis and drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.
Formula:C16H19NO
InChI:InChI=1/C16H19NO/c1-13(17-2)15-9-6-10-16(11-15)18-12-14-7-4-3-5-8-14/h3-11,13,17H,12H2,1-2H3
SMILES:CC(c1cccc(c1)OCc1ccccc1)NC
Synonyms:
  • N,a-Dimethyl-3-(phenylmethoxy)benzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.