CymitQuimica logo

CAS 1239319-94-8

:

tert-butyl 2-amino-6-azaspiro[3.4]octane-6-carboxylate

Description:
Tert-butyl 2-amino-6-azaspiro[3.4]octane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework that includes a nitrogen atom within the ring system. This compound typically exhibits properties associated with both amines and carboxylates, making it a potential candidate for various applications in medicinal chemistry and drug development. The tert-butyl group contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the spiro structure can impart rigidity, which may affect the compound's conformational dynamics and interactions with biological targets. Overall, tert-butyl 2-amino-6-azaspiro[3.4]octane-6-carboxylate represents a complex molecule with interesting chemical properties that could be explored for therapeutic uses or as a building block in synthetic chemistry.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-5-4-12(8-14)6-9(13)7-12/h9H,4-8,13H2,1-3H3
InChI key:TWNDWKDXPSDFLL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(C1)CC(C2)N
Found 5 products.