CAS 1239351-97-3

3,4-Difluoro-2-pyridinecarboxaldehyde

Description:

3,4-Difluoro-2-pyridinecarboxaldehyde is an organic compound characterized by the presence of a pyridine ring substituted with two fluorine atoms and an aldehyde functional group. The molecular structure features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, and the aldehyde group (-CHO) is attached to the carbon adjacent to the nitrogen. The presence of fluorine atoms enhances the compound's reactivity and polarity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its properties, such as boiling point, melting point, and solubility, are influenced by the electronegative fluorine substituents, which can also affect its interaction with biological systems. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactive nature.

Formula: C₆H₃F₂NO

InChI: InChI=1S/C6H3F2NO/c7-4-1-2-9-5(3-10)6(4)8/h1-3H

InChI key: InChIKey=MODCKWZVKBXDPO-UHFFFAOYSA-N

SMILES: C(=O)C1=C(F)C(F)=CC=N1

Synonyms:

• 3,4-Difluoro-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 3,4-difluoro-