CAS 123940-54-5

Hypocrellin B

Description:

Hypocrellin B is a natural compound classified as a perylenequinone, primarily derived from the fungus Hypocrea lixii. It exhibits a distinctive dark red to purple color and is known for its photosensitizing properties, making it of interest in photodynamic therapy (PDT) for cancer treatment. The compound has a complex molecular structure characterized by multiple fused aromatic rings, contributing to its strong light absorption in the visible spectrum. Hypocrellin B is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and therapeutic application. In addition to its potential in cancer therapy, it has shown antimicrobial and antiviral activities, further expanding its relevance in medicinal chemistry. The compound's mechanism of action involves the generation of reactive oxygen species upon light activation, leading to cellular damage in targeted tissues. Overall, Hypocrellin B represents a promising candidate in the field of photomedicine, with ongoing research aimed at optimizing its efficacy and safety for clinical use.

Formula: C₃₀H₂₄O₉

InChI: InChI=1S/C30H24O9/c1-10-7-12-18-23-19(27(34)29(12)38-5)13(32)8-15(36-3)21(23)22-16(37-4)9-14(33)20-25(22)24(18)26(17(10)11(2)31)30(39-6)28(20)35/h8-9,32-33H,7H2,1-6H3

InChI key: InChIKey=APTUSGMALOMQQL-UHFFFAOYSA-N

SMILES: O(C)C1=C2C=3C4=C5C(=C6C3C(C1=O)=C(O)C=C6OC)C(OC)=CC(O)=C5C(=O)C(OC)=C4CC(C)=C2C(C)=O

Synonyms:

• 1H-Cyclohepta[ghi]perylene-5,12-dione, 3-acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-
• 3-Acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-1H-cyclohepta[ghi]perylene-5,12-dione
• 6-acetyl-8,9-dihydroxy-3,7,11,12-tetramethoxy-5-methyl-1H-cyclohepta[ghi]perylene-1,2(4H)-dione
• Hc-B
• Hypocrelin B
• Hypocrellin B, Hypocrella Bambusae
• Hypocrellin B

Hypocrellin B

CAS: 123940-54-5

Formula: C₃₀H₂₆O₉

Purity: 98%

Molecular weight: 530.5220

Ref: IN-DA009C1F

Hypocrellin B

CAS: 123940-54-5

Formula: C₃₀H₂₄O₉

Molecular weight: 528.51

Ref: 7W-GY4806

HYPOCRELLIN B

CAS: 123940-54-5

HYPOCRELLIN B

Purity: ≥98%

Molecular weight: 528.51g/mol

Ref: 54-BUP01451

Hypocrellin B

CAS: 123940-54-5

Hypocrellin B has sonodynamic action to induce mitochondrial damage, survival inhibition, apoptosis and inhibit adhesion and migration of cancer cells. Photodynamic therapy with Hypocrellin B can remarkably induce apoptosis and inhibit adhesion and migration of cancer cells in vitro.

Formula: C₃₀H₂₄O₉

Purity: 95%~99%

Molecular weight: 528.513

Ref: BP-BP0755

HYPOCRELLIN B

CAS: 123940-54-5

HYPOCRELLIN B, from Hypocrella bambusae, breaks DNA, triggers apoptosis in ovarian cells, and stops Staphylococcus growth via ROS.

Formula: C₃₀H₂₄O₉

Purity: 98% - 98.87%

Color and Shape: Solid

Molecular weight: 528.51

Ref: TM-T5780

Hypocrellin B

CAS: 123940-54-5

Hypocrellin B is a photosensitizer, which is a compound capable of generating reactive oxygen species upon light activation. It is derived from the perylenequinone family of compounds, primarily sourced from fungi such as Shiraia bambusicola. The mode of action of Hypocrellin B involves the generation of singlet oxygen and other reactive oxygen species when exposed to specific wavelengths of light. This oxidative process can induce cellular damage, making it effective in targeting abnormal cells.

Formula: C₃₀H₂₄O₉

Purity: Min. 95%

Molecular weight: 528.51 g/mol

Ref: 3D-YEA94054