
CAS 1239602-35-7
:4′,4′′′,4′′′′′-Nitrilotris[[1,1′-biphenyl]-4-carboxylic acid]
Description:
4′,4′′′,4′′′′′-Nitrilotris[[1,1′-biphenyl]-4-carboxylic acid], identified by its CAS number 1239602-35-7, is a complex organic compound characterized by its three-dimensional structure featuring multiple biphenyl units and carboxylic acid functional groups. This compound exhibits significant potential in various applications, particularly in materials science and organic synthesis, due to its ability to form coordination complexes and its potential as a ligand. The presence of multiple carboxylic acid groups contributes to its solubility in polar solvents and enhances its reactivity, making it suitable for further chemical modifications. Additionally, the biphenyl moieties may impart unique electronic properties, which can be advantageous in the development of organic electronic devices. The compound's stability and reactivity can be influenced by factors such as pH and temperature, and it may exhibit interesting interactions with metal ions, making it a subject of interest in coordination chemistry. Overall, this substance represents a fascinating area of study within organic and coordination chemistry.
Formula:C39H27NO6
InChI:InChI=1S/C39H27NO6/c41-37(42)31-7-1-25(2-8-31)28-13-19-34(20-14-28)40(35-21-15-29(16-22-35)26-3-9-32(10-4-26)38(43)44)36-23-17-30(18-24-36)27-5-11-33(12-6-27)39(45)46/h1-24H,(H,41,42)(H,43,44)(H,45,46)
InChI key:InChIKey=NWYGETXZXGDGKD-UHFFFAOYSA-N
SMILES:N(C1=CC=C(C=C1)C2=CC=C(C(O)=O)C=C2)(C3=CC=C(C=C3)C4=CC=C(C(O)=O)C=C4)C5=CC=C(C=C5)C6=CC=C(C(O)=O)C=C6
Synonyms:- 4′,4′′′,4′′′′′-Nitrilotris[1,1′-biphenyl]-4-carboxylic acid
- 4′,4′′′,4′′′′′-Nitrilotris[[1,1′-biphenyl]-4-carboxylic acid]
- [1,1′-Biphenyl]-4-carboxylic acid, 4′,4′′′,4′′′′′-nitrilotris-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4',4''',4'''''-Nitrilotris(([1,1'-biphenyl]-4-carboxylic acid))
CAS:Formula:C39H27NO6Purity:97%Color and Shape:SolidMolecular weight:605.63484’,4’’’,4’’’’’-Nitrilotris(([1,1’-Biphenyl]-4-Carboxylic Acid))
CAS:4’,4’’’,4’’’’’-Nitrilotris(([1,1’-Biphenyl]-4-Carboxylic Acid))Purity:98%Molecular weight:605.63g/molAntibacterial agent 18
CAS:Antibacterial agent 18 is a multi-armed AIE molecule with antibacterial activity, inhibiting the growth of both Gram-positive and Gram-negative bacteria.Formula:C39H27NO6Purity:98.08%Color and Shape:SolidMolecular weight:605.64Tris(4'-carboxy-1,1'-biphenyl)amine
CAS:Tris(4'-carboxy-1,1'-biphenyl)amine is an organic compound commonly employed as a building block in the development of advanced materials. It is synthesized through a series of chemical reactions involving biphenyl and aniline derivatives, ultimately producing a triphenylamine core with carboxylic acid functional groups. The unique molecular architecture allows this compound to participate in various chemical interactions, including π-π stacking and hydrogen bonding, which are pivotal in its applications.
Formula:C39H27NO6Purity:Min. 95%Molecular weight:605.6 g/mol



