CAS 1239603-54-3

1-[2-(2-Methoxyphenyl)ethenyl]naphthalene

Description:

1-[2-(2-Methoxyphenyl)ethenyl]naphthalene, identified by its CAS number 1239603-54-3, is an organic compound characterized by its complex structure, which includes a naphthalene core and a methoxyphenyl substituent connected via a vinyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to its conjugated system. It may display fluorescence, making it of interest in applications such as organic light-emitting diodes (OLEDs) and other optoelectronic devices. The presence of the methoxy group can influence its solubility and reactivity, potentially enhancing its electron-donating properties. Additionally, the compound may participate in various chemical reactions, including electrophilic substitutions and polymerization processes. Its unique structural features and potential applications in materials science and organic synthesis make it a subject of interest in both academic and industrial research. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₉H₁₆O

InChI: InChI=1S/C19H16O/c1-20-19-12-5-3-8-17(19)14-13-16-10-6-9-15-7-2-4-11-18(15)16/h2-14H,1H3

InChI key: InChIKey=ULBRDGVKPMHVOP-UHFFFAOYSA-N

SMILES: C(=CC1=C(OC)C=CC=C1)C=2C3=C(C=CC2)C=CC=C3

Synonyms:

• 1-[2-(2-Methoxyphenyl)ethenyl]naphthalene
• Naphthalene, 1-[2-(2-methoxyphenyl)ethenyl]-

1-[2-(2-Methoxyphenyl)ethenyl]-naphthalene

Controlled Product

CAS: 1239603-54-3

Formula: C₁₉H₁₆O

Color and Shape: Neat

Molecular weight: 260.33

Ref: TR-M263515