CAS 1239611-34-7

3-Bromo-2-methyl-6-(1-methylethoxy)pyridine

Description:

3-Bromo-2-methyl-6-(1-methylethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a 1-methylethoxy group at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative bromine and nitrogen atoms, influencing its solubility in various solvents. The methyl group at the 2-position can provide steric hindrance, affecting reactivity and interaction with other molecules. Additionally, the 1-methylethoxy substituent may enhance lipophilicity, making it more soluble in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives often exhibit biological activity. However, specific reactivity and stability would depend on the conditions under which it is used, including temperature, pH, and the presence of other reagents. Safety data should be consulted for handling and storage due to the presence of bromine, which can be hazardous.

Formula: C₉H₁₂BrNO

InChI: InChI=1S/C9H12BrNO/c1-6(2)12-9-5-4-8(10)7(3)11-9/h4-6H,1-3H3

InChI key: InChIKey=GYOFZTOVTHSQLP-UHFFFAOYSA-N

SMILES: O(C(C)C)C=1N=C(C)C(Br)=CC1

Synonyms:

• 3-Bromo-6-isopropoxypicoline
• PY 1673
• 3-Bromo-6-isopropoxy-2-methylpyridine
• 3-Bromo-2-methyl-6-(1-methylethoxy)pyridine
• Pyridine, 3-bromo-2-methyl-6-(1-methylethoxy)-

Pyridine, 3-bromo-2-methyl-6-(1-methylethoxy)-

CAS: 1239611-34-7

Formula: C₉H₁₂BrNO

Purity: 97%

Molecular weight: 230.1017

Ref: IN-DA000LAJ