
CAS 1239723-28-4
:7-(Phenyl-1-pyrrolidinylmethyl)-8-quinolinol
Description:
7-(Phenyl-1-pyrrolidinylmethyl)-8-quinolinol, identified by its CAS number 1239723-28-4, is a chemical compound that features a quinoline core substituted with a phenyl group and a pyrrolidine moiety. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where quinoline derivatives are often explored for their pharmacological properties. The presence of the pyrrolidine ring may contribute to its ability to interact with biological targets, potentially influencing its efficacy and selectivity. Additionally, the phenyl group can enhance lipophilicity, which may affect the compound's absorption and distribution in biological systems. The compound's structure suggests it may exhibit properties such as chelation of metal ions, which is a common feature of quinoline derivatives, and it may also possess antioxidant or antimicrobial activities. However, specific biological activities and mechanisms of action would require further investigation through experimental studies. Overall, this compound represents a class of molecules with diverse applications in drug discovery and development.
Formula:C20H20N2O
InChI:InChI=1S/C20H20N2O/c23-20-17(11-10-15-9-6-12-21-18(15)20)19(22-13-4-5-14-22)16-7-2-1-3-8-16/h1-3,6-12,19,23H,4-5,13-14H2
InChI key:InChIKey=DMPJVOWKYCKFJN-UHFFFAOYSA-N
SMILES:C(C1=C(O)C2=C(C=C1)C=CC=N2)(N3CCCC3)C4=CC=CC=C4
Synonyms:- 7-(Phenyl-1-pyrrolidinylmethyl)-8-quinolinol
- 8-Quinolinol, 7-(phenyl-1-pyrrolidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.