CAS 123973-25-1
:2-Fluoro-3-(trifluoromethyl)aniline
Description:
2-Fluoro-3-(trifluoromethyl)aniline is an aromatic amine characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a fluorine substituent at the second position and a trifluoromethyl group at the third position relative to the amino group. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits moderate solubility in organic solvents and is less soluble in water due to its hydrophobic trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. As with many fluorinated compounds, it may exhibit unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity.
Formula:C7H5F4N
InChI:InChI=1/C7H5F4N/c8-6-4(7(9,10)11)2-1-3-5(6)12/h1-3H,12H2
SMILES:c1cc(c(c(c1)N)F)C(F)(F)F
Synonyms:- 3-Amino-2-Fluorobenzotrifluoride
- Alpha,Alpha,Alpha,2-Tetrafluoro-M-Toluidine
- Buttpark 45\01-71
- 2-Fluoro-3-aminobenzotrifluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-3-(trifluoromethyl)aniline
CAS:Formula:C7H5F4NPurity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:179.12Benzenamine, 2-fluoro-3-(trifluoromethyl)-
CAS:Formula:C7H5F4NPurity:97%Color and Shape:LiquidMolecular weight:179.11493-Amino-2-fluorobenzotrifluoride
CAS:3-Amino-2-fluorobenzotrifluorideFormula:C7H5F4NPurity:98%Color and Shape: clear. faint yellow liquidMolecular weight:179.11g/mol3-Amino-2-fluorobenzotrifluoride
CAS:Formula:C7H5F4NPurity:98%Color and Shape:LiquidMolecular weight:179.1182-Fluoro-3-(trifluoromethyl)aniline
CAS:Controlled ProductApplications 2-Fluoro-3-(trifluoromethyl)aniline is a buliding block for various inhibitors such as 5,6,7-Trimethoxy-N-phenyl(ethyl)-4-aminoquinazoline derivatives that have anticancer activities and N-[3-(Phenylcarbamoyl)aryl]pyrimidine-5-carboxamide that are lymphocyte-specific kinase inhibitors.
References Zhang, Y., et al.: Eur. J. Med. Chem., 66, 335 (2013); Deak, H., et al.: Bioorg. Med. Chem. Lett., 18, 1172 (2008)Formula:C7H5F4NColor and Shape:NeatMolecular weight:179.11




