CAS 1239734-54-3

Ethyl 4-bromo-5-methoxy-1-methyl-1H-pyrazole-3-carboxylate

Description:

Ethyl 4-bromo-5-methoxy-1-methyl-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a methoxy group at the 5-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The ethyl ester functional group at the 3-position enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of new therapeutic agents. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, Ethyl 4-bromo-5-methoxy-1-methyl-1H-pyrazole-3-carboxylate represents a versatile building block in synthetic organic chemistry.

Formula: C₈H₁₁BrN₂O₃

InChI: InChI=1S/C8H11BrN2O3/c1-4-14-8(12)6-5(9)7(13-3)11(2)10-6/h4H2,1-3H3

InChI key: InChIKey=PDVHRTALUNKHEA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(Br)=C(OC)N(C)N1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4-bromo-5-methoxy-1-methyl-, ethyl ester
• Ethyl 4-bromo-5-methoxy-1-methyl-1H-pyrazole-3-carboxylate