CAS 1239775-53-1

3-Quinolinecarboxylic acid, 6-methyl-, ethyl ester

Description:

3-Quinolinecarboxylic acid, 6-methyl-, ethyl ester is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group that is esterified with an ethyl group, contributing to its solubility and reactivity. The presence of a methyl group at the 6-position of the quinoline ring influences its chemical properties, including its acidity and potential for hydrogen bonding. Typically, compounds of this nature exhibit moderate to high lipophilicity, making them relevant in medicinal chemistry and drug design. They may also demonstrate biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. The compound's stability, reactivity, and interaction with biological systems can be influenced by factors such as pH, temperature, and the presence of other functional groups. Overall, 3-Quinolinecarboxylic acid, 6-methyl-, ethyl ester represents a versatile structure with applications in various chemical and pharmaceutical fields.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-3-16-13(15)11-7-10-6-9(2)4-5-12(10)14-8-11/h4-8H,3H2,1-2H3

InChI key: InChIKey=CUUHXGARWNZEHX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC2=C(N=C1)C=CC(C)=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 6-methyl-, ethyl ester
• Ethyl 6-methylquinoline-3-carboxylate