CymitQuimica logo

CAS 1239787-62-2

:

5-[3-(2-Methoxyethyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone

Description:
5-[3-(2-Methoxyethyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone is a chemical compound characterized by its unique structural features, which include a pyridinone ring and an oxadiazole moiety. The presence of the methoxyethyl group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential pharmacological activities, including antimicrobial or anti-inflammatory effects, although specific biological data would depend on empirical studies. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making this compound of interest in medicinal chemistry. Additionally, the compound's molecular interactions, such as hydrogen bonding and π-π stacking, could play a significant role in its reactivity and potential applications. As with many organic compounds, its behavior in different solvents and under varying conditions can significantly affect its stability and reactivity, making it a subject of interest for further research in both synthetic and applied chemistry.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c1-15-5-4-8-12-10(16-13-8)7-2-3-9(14)11-6-7/h2-3,6H,4-5H2,1H3,(H,11,14)
InChI key:InChIKey=BCWNGPPKZDNNCO-UHFFFAOYSA-N
SMILES:C(COC)C=1N=C(ON1)C=2C=CC(=O)NC2
Synonyms:
  • 5-[3-(2-Methoxyethyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.