
CAS 123983-06-2
:2-[(1S)-1-Aminopropyl]phenol
Description:
2-[(1S)-1-Aminopropyl]phenol, also known by its CAS number 123983-06-2, is an organic compound characterized by the presence of both an amino group and a phenolic hydroxyl group. This compound features a chiral center, which contributes to its stereochemistry, specifically the (1S) configuration of the aminopropyl group. The phenolic structure imparts certain properties, such as potential antioxidant activity and the ability to participate in hydrogen bonding, which can influence its solubility and reactivity. The amino group can engage in various interactions, including forming salts with acids and participating in nucleophilic reactions. This compound may be of interest in pharmaceutical and biochemical research due to its potential biological activity, including effects on neurotransmitter systems. Its characteristics, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-[(1S)-1-Aminopropyl]phenol represents a versatile structure with implications in medicinal chemistry and related fields.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-2-8(10)7-5-3-4-6-9(7)11/h3-6,8,11H,2,10H2,1H3/t8-/m0/s1
InChI key:InChIKey=SJYRIEHMQRIBEN-QMMMGPOBSA-N
SMILES:[C@@H](CC)(N)C1=C(O)C=CC=C1
Synonyms:- 2-[(1S)-1-Aminopropyl]phenol
- (S)-2-(1-Aminopropyl)phenol
- Phenol, 2-[(1S)-1-aminopropyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.