
CAS 123983-07-3
:Benzenemethanamine, α-methyl-3-(phenylmethoxy)-, hydrochloride, (-)-
Description:
Benzenemethanamine, α-methyl-3-(phenylmethoxy)-, hydrochloride, also known by its CAS number 123983-07-3, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a phenylmethoxy group, which contributes to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound exhibits chiral properties, indicated by the presence of the (-) designation, suggesting that it may have specific interactions with biological systems, potentially influencing its pharmacological effects. Its molecular structure includes an amine functional group, which can participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and related fields, where understanding its properties can lead to the development of therapeutic agents.
Formula:C15H17NO·ClH
InChI:InChI=1/C15H17NO.ClH/c1-12(16)14-8-5-9-15(10-14)17-11-13-6-3-2-4-7-13;/h2-10,12H,11,16H2,1H3;1H
InChI key:InChIKey=GSMJUVHGBWUTQK-UHFFFAOYNA-N
SMILES:O(CC1=CC=CC=C1)C2=CC(C(C)N)=CC=C2.Cl
Synonyms:- 1-[3-(Benzyloxy)phenyl]ethan-1-amine hydrochloride
- Benzenemethanamine, α-methyl-3-(phenylmethoxy)-, hydrochloride, (-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.