CAS 1239843-30-1

5-[3-(4-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone

Description:

5-[3-(4-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone is a chemical compound characterized by its complex structure, which includes a pyridinone moiety and an oxadiazole ring. This compound features a pyridine ring substituted at the 4-position, contributing to its potential biological activity. The oxadiazole ring, known for its heterocyclic properties, enhances the compound's stability and reactivity. Typically, compounds of this nature exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. They may possess activities such as antimicrobial, anti-inflammatory, or anticancer effects, although specific biological activities would depend on further empirical studies. The presence of nitrogen and oxygen atoms in the structure suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the compound's solubility, melting point, and reactivity would be influenced by its functional groups and overall molecular geometry. As with many heterocyclic compounds, its synthesis and characterization would involve various organic chemistry techniques to confirm its structure and purity.

Formula: C₁₂H₈N₄O₂

InChI: InChI=1S/C12H8N4O2/c17-10-2-1-9(7-14-10)12-15-11(16-18-12)8-3-5-13-6-4-8/h1-7H,(H,14,17)

InChI key: InChIKey=HKTUEAUYNIGIBW-UHFFFAOYSA-N

SMILES: O=C1C=CC(C2=NC(=NO2)C=3C=CN=CC3)=CN1

Synonyms:

• 5-[3-(4-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]-