
CAS 123989-28-6
:4-Chloro-α-(1-cyclopropylethyl)benzenemethanol
Description:
4-Chloro-α-(1-cyclopropylethyl)benzenemethanol, identified by its CAS number 123989-28-6, is an organic compound characterized by the presence of a chlorobenzene moiety and a cyclopropyl group. This compound features a hydroxymethyl group (-CH2OH) attached to a benzene ring, which contributes to its potential as a versatile intermediate in organic synthesis. The chlorinated aromatic structure may impart unique electronic properties, influencing its reactivity and interactions in various chemical environments. The cyclopropyl substituent can introduce strain and steric effects, which may affect the compound's conformation and reactivity. Additionally, the presence of the hydroxymethyl group suggests potential for hydrogen bonding, which could influence solubility and biological activity. Overall, this compound may be of interest in medicinal chemistry and materials science due to its structural features and potential applications in drug development or as a building block in synthetic pathways.
Formula:C12H15ClO
InChI:InChI=1S/C12H15ClO/c1-8(9-2-3-9)12(14)10-4-6-11(13)7-5-10/h4-9,12,14H,2-3H2,1H3
InChI key:InChIKey=MMHBKNHHEADGHK-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=C(Cl)C=C1)(C)C2CC2
Synonyms:- Benzenemethanol, 4-chloro-α-(1-cyclopropylethyl)-
- 1-(4-Chlorophenyl)-2-cyclopropylpropan-1-ol
- 4-Chloro-α-(1-cyclopropylethyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.