CAS 1239964-07-8

3-Bromo-4-fluoro-α,α-dimethylbenzeneacetaldehyde

Description:

3-Bromo-4-fluoro-α,α-dimethylbenzeneacetaldehyde is an organic compound characterized by the presence of a bromine and a fluorine atom attached to a benzene ring, along with an aldehyde functional group. The structure features a dimethyl substitution on the alpha position relative to the aldehyde, which contributes to its steric properties. This compound is likely to exhibit moderate polarity due to the presence of the aldehyde group, which can participate in hydrogen bonding. The bromine and fluorine substituents can influence the compound's reactivity, stability, and electronic properties, potentially making it useful in various synthetic applications or as an intermediate in organic synthesis. Additionally, the presence of halogens may impart unique characteristics such as increased lipophilicity or altered solubility in different solvents. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₀H₁₀BrFO

InChI: InChI=1S/C10H10BrFO/c1-10(2,6-13)7-3-4-9(12)8(11)5-7/h3-6H,1-2H3

InChI key: InChIKey=CIXMAYTXIMHHCI-UHFFFAOYSA-N

SMILES: C(C=O)(C)(C)C1=CC(Br)=C(F)C=C1

Synonyms:

• Benzeneacetaldehyde, 3-bromo-4-fluoro-α,α-dimethyl-
• 2-(3-Bromo-4-fluorophenyl)-2-methylpropanal
• 3-Bromo-4-fluoro-α,α-dimethylbenzeneacetaldehyde