CAS 124-16-3

1-(Butoxyethoxy)-2-propanol

Description:

1-(Butoxyethoxy)-2-propanol, also known as butoxyethoxypropanol, is an organic compound characterized by its ether functional groups and a propanol backbone. It is a colorless to pale yellow liquid with a mild odor, commonly used as a solvent in various applications, including coatings, cleaning products, and inks. The compound exhibits good solubility in water and organic solvents, making it versatile for formulation purposes. Its molecular structure contributes to its properties, such as moderate volatility and a relatively low surface tension, which enhance its effectiveness as a surfactant and solvent. Additionally, it has a relatively high flash point, indicating a lower risk of ignition under standard conditions. Safety data sheets typically classify it as a mild irritant, emphasizing the importance of handling it with appropriate safety measures. Overall, 1-(Butoxyethoxy)-2-propanol is valued in industrial applications for its solvent capabilities and compatibility with various materials.

Formula: C₉H₂₀O₃

InChI: InChI=1S/C9H20O3/c1-3-4-5-11-6-7-12-8-9(2)10/h9-10H,3-8H2,1-2H3

InChI key: InChIKey=NPMRPDRLIHYOBW-UHFFFAOYSA-N

SMILES: C(COCCCC)OCC(C)O

Synonyms:

• 1-(2-Butoxyethoxy)-2-propanol
• 2-Butoxy-1-(2-hydroxypropoxy)ethane
• 1-(Butoxyethoxy)-2-propanol
• 2-Propanol, 1-(2-butoxyethoxy)-
• 4,7-Dioxaundecan-2-ol

2-Propanol, 1-(2-butoxyethoxy)-

CAS: 124-16-3

Formula: C₉H₂₀O₃

Molecular weight: 176.2533

Ref: IN-DA000LDK