CAS 124-47-0
:Urea nitrate
Description:
Urea nitrate, with the CAS number 124-47-0, is a chemical compound formed from the reaction of urea and nitric acid. It appears as a white crystalline solid and is highly soluble in water. Urea nitrate is primarily known for its use as a nitrogen fertilizer, as it provides both urea and nitrate nitrogen, which are essential for plant growth. Additionally, it has applications in the production of explosives due to its high nitrogen content and energy release upon decomposition. The compound is hygroscopic, meaning it can absorb moisture from the environment, which can affect its stability and handling. Urea nitrate is classified as a potential explosive material, and thus, it requires careful storage and handling to prevent unintended detonation. Safety precautions are essential when working with this substance, as it can pose risks if not managed properly. Overall, urea nitrate is a versatile compound with significant agricultural and industrial applications, but it must be treated with caution due to its explosive potential.
Formula:CH4N2O·HNO3
InChI:InChI=1S/CH4N2O.HNO3/c2*2-1(3)4/h(H4,2,3,4);(H,2,3,4)
InChI key:InChIKey=AYTGUZPQPXGYFS-UHFFFAOYSA-N
SMILES:N(=O)(=O)O.C(N)(N)=O
Synonyms:- Urea nitrate
- Acidogen nitrate
- Hsdb 1021
- Urea mononitrate
- Urea nitrate (wet)
- Un0220
- Un1357
- Urea Nitrate (1:1)
- Amino(Oxo)Methanaminium Nitrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Urea nitrate
CAS:<p>Urea nitrate is an analog of urea that has been shown to have potent anticancer activity. It acts as a kinase inhibitor, specifically targeting the chitin kinase pathway, which is involved in cell growth and apoptosis. Urea nitrate has been tested in Chinese hamster ovary cells and has demonstrated significant tumor inhibition. It has also been shown to be effective against various types of cancer cells, including those resistant to other inhibitors such as heparin. Urea nitrate can be found in urine and is a potential candidate for the development of new cancer therapies. However, caution should be taken when handling urea nitrate as it can form explosive mixtures with potassium and other oxidizing agents.</p>Formula:CH4N2O·HNO3Purity:Min. 95%Molecular weight:123.07 g/mol
