CAS 124-85-6
:Pregn-2-en-20-yn-17-ol, 17-acetate, (5α,17α)-
Description:
Pregn-2-en-20-yn-17-ol, 17-acetate, (5α,17α)-, commonly known as a steroid compound, is characterized by its complex structure that includes a steroid backbone with specific functional groups. This compound features a double bond at the 2-position and a triple bond at the 20-position, contributing to its unique reactivity and biological activity. The presence of a hydroxyl group at the 17-position, along with an acetate group, indicates that it can undergo various chemical transformations, making it relevant in biochemical pathways. Steroids like this one are often involved in hormonal functions and can exhibit significant pharmacological effects. The stereochemistry, particularly the 5α and 17α configurations, plays a crucial role in determining the compound's interaction with biological receptors. Overall, this compound is of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications and its role in the study of steroid hormones.
Formula:C23H32O2
InChI:InChI=1S/C23H32O2/c1-5-23(25-16(2)24)15-12-20-18-10-9-17-8-6-7-13-21(17,3)19(18)11-14-22(20,23)4/h1,6-7,17-20H,8-15H2,2-4H3/t17-,18-,19+,20+,21+,22+,23+/m1/s1
InChI key:InChIKey=SQRBBVVZRKZEPF-OWNQEUAMSA-N
SMILES:O(C(C)=O)[C@]1(C#C)[C@]2(C)[C@@](CC1)([C@]3([C@](CC2)([C@]4(C)[C@@](CC3)(CC=CC4)[H])[H])[H])[H]
Synonyms:- 17α-Ethynyl-5α-androst-2-en 17β-acetate
- 17α-Ethynyl-5α-androst-2-en-17β-ol 17β-acetate
- Pregn-2-en-20-yn-17-ol, 17-acetate, (5α,17α)-
- 5α,17α-Pregn-2-en-20-yn-17-ol, acetate
- Pregn-2-en-20-yn-17-ol, acetate, (5α,17α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
