CAS 1240-37-5
:N,N′-Di-1-naphthalenylthiourea
Description:
N,N′-Di-1-naphthalenylthiourea, with the CAS number 1240-37-5, is an organic compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to two nitrogen atoms. This compound features two naphthyl groups, which are derived from naphthalene, a polycyclic aromatic hydrocarbon. The presence of these naphthyl groups contributes to its aromatic properties and potential applications in various fields, including organic synthesis and materials science. N,N′-Di-1-naphthalenylthiourea is known for its role as a ligand in coordination chemistry and may exhibit interesting photophysical properties due to its conjugated structure. Additionally, it may possess biological activity, making it a subject of interest in medicinal chemistry. The compound is typically solid at room temperature and may have specific solubility characteristics depending on the solvent used. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C21H16N2S
InChI:InChI=1S/C21H16N2S/c24-21(22-19-13-5-9-15-7-1-3-11-17(15)19)23-20-14-6-10-16-8-2-4-12-18(16)20/h1-14H,(H2,22,23,24)
InChI key:InChIKey=VFCZSWPNOOGGAJ-UHFFFAOYSA-N
SMILES:N(C(NC=1C2=C(C=CC1)C=CC=C2)=S)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- 1,3-Di-α-naphthylthiourea
- N,N′-Di-α-naphthylthiourea
- Urea, 1,3-di-1-naphthyl-2-thio-
- N,N′-Di-1-naphthalenylthiourea
- Thiourea, N,N′-di-1-naphthalenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
