CymitQuimica logo

CAS 124005-68-1

:

1-(2,3,5,6-tetrafluorophenyl)imidazole

Description:
1-(2,3,5,6-tetrafluorophenyl)imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the tetrafluorophenyl group significantly influences its chemical properties, imparting high electronegativity and altering its reactivity. This compound is typically a solid at room temperature and may exhibit a crystalline structure. Its fluorinated aromatic system enhances its lipophilicity and stability, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The imidazole moiety is known for its role in biological systems, often acting as a building block in drug design due to its ability to form hydrogen bonds and participate in coordination chemistry. Additionally, the presence of multiple fluorine atoms can enhance the compound's metabolic stability and influence its interaction with biological targets. Overall, 1-(2,3,5,6-tetrafluorophenyl)imidazole is a versatile compound with significant potential in medicinal chemistry and material science.
Formula:C9H4F4N2
InChI:InChI=1/C9H4F4N2/c10-5-3-6(11)8(13)9(7(5)12)15-2-1-14-4-15/h1-4H
SMILES:c1cn(cn1)c1c(c(cc(c1F)F)F)F
Synonyms:
  • 1-(2,3,5,6-tetrafluorophenyl)-1H-imidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.