
CAS 124009-64-9
:α-(1,1-Dimethylethyl)-3-pyridinemethanol
Description:
α-(1,1-Dimethylethyl)-3-pyridinemethanol, also known by its CAS number 124009-64-9, is an organic compound characterized by its pyridine ring and a tertiary butyl group. This compound features a hydroxymethyl group attached to the pyridine, which contributes to its potential as a versatile intermediate in organic synthesis. The presence of the bulky tert-butyl group enhances its steric properties, influencing its reactivity and solubility in various solvents. Typically, compounds of this nature exhibit moderate polarity due to the combination of the hydrophobic tert-butyl group and the polar hydroxymethyl and pyridine functionalities. This structure may also impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, α-(1,1-Dimethylethyl)-3-pyridinemethanol serves as a valuable building block in the synthesis of more complex molecules in pharmaceutical and chemical research.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-10(2,3)9(12)8-5-4-6-11-7-8/h4-7,9,12H,1-3H3
InChI key:InChIKey=HTHPRKBXKKWGMM-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(O)C=1C=CC=NC1
Synonyms:- 2,2-Dimethyl-1-(pyridin-3-yl)propan-1-ol
- 3-(2,2-Dimethyl-1-hydroxypropyl)pyridine
- 3-Pyridinemethanol, α-(1,1-dimethylethyl)-
- α-(1,1-Dimethylethyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.