CAS 124020-39-9

(3aR,4aS,6aS,7S,9aS,9bR)-5,6,6a,7,9a,9b-Hexahydro-1,4a,7-trimethyl-3H-oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione

Description:

The chemical substance with the name "(3aR,4aS,6aS,7S,9aS,9bR)-5,6,6a,7,9a,9b-Hexahydro-1,4a,7-trimethyl-3H-oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione" and CAS number "124020-39-9" is a complex organic compound characterized by its unique bicyclic structure, which includes multiple fused rings and functional groups. This compound features a furan moiety and an oxirane ring, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the specific R and S designations suggests that the molecule has several chiral centers, which can influence its interactions with biological systems and its overall properties. Such compounds may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, the presence of multiple methyl groups can affect the compound's hydrophobicity and solubility, which are critical factors in drug design and development. Overall, this substance represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₅H₁₈O₄

InChI: InChI=1S/C15H18O4/c1-7-6-10(16)15-11(7)12-9(8(2)13(17)18-12)4-5-14(15,3)19-15/h6,8-9,11-12H,4-5H2,1-3H3/t8-,9-,11+,12-,14-,15+/m0/s1

InChI key: InChIKey=WLWQUBMOSXUFJB-YFRBHOLXSA-N

SMILES: C[C@@]12[C@@]3([C@@]([C@@]4([C@@](CC1)([C@H](C)C(=O)O4)[H])[H])(C(C)=CC3=O)[H])O2

Synonyms:

• 3H-Oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione, 5,6,6a,7,9a,9b-hexahydro-1,4a,7-trimethyl-, (3aR,4aS,6aS,7S,9aS,9bR)-
• (3aR,4aS,6aS,7S,9aS,9bR)-5,6,6a,7,9a,9b-Hexahydro-1,4a,7-trimethyl-3H-oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione
• 3H-Oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione, 5,6,6a,7,9a,9b-hexahydro-1,4a,7-trimethyl-, [4aS-(3aS*,4aα,6aα,7α,9aβ,9bα)]-
• (+)-1β,10β-Epoxydesacetoxymatricarin

3H-Oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione, 5,6,6a,7,9a,9b-hexahydro-1,4a,7-trimethyl-, (3aR,4aS,6aS,7S,9aS,9bR)-

CAS: 124020-39-9

Formula: C₁₅H₁₈O₄

Purity: 98.0%

Molecular weight: 262.3010

Ref: IN-DA01OY9F

1β,10β-Epoxydesacetoxymatricarin

CAS: 124020-39-9

1β,10β-Epoxydesacetoxymatricarin is a sesquiterpene lactone, which is a type of naturally occurring organic compound. It is primarily sourced from plants in the Asteraceae family, such as the genus Matricaria, commonly known for its medicinal properties.

Formula: C₁₅H₁₈O₄

Purity: Min. 95%

Molecular weight: 262.3 g/mol

Ref: 3D-ZEA02039