CAS 1240217-90-6
:N-[(3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-(4-ethoxyphenyl)glycine
Description:
N-[(3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-(4-ethoxyphenyl)glycine is a chemical compound characterized by its unique structure, which includes a glycine moiety linked to a sulfonyl group and a substituted pyrazole. The presence of the 3,5-dimethyl-1H-pyrazole ring contributes to its potential biological activity, while the ethoxyphenyl group enhances its lipophilicity, possibly affecting its solubility and permeability. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its sulfonamide functional group can influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could be significant in its pharmacodynamics and pharmacokinetics. Overall, N-[(3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-(4-ethoxyphenyl)glycine represents a class of compounds that may be explored for therapeutic applications, although specific biological activities would require further investigation.
Formula:C15H19N3O5S
InChI:InChI=1S/C15H19N3O5S/c1-4-23-13-7-5-12(6-8-13)18(9-14(19)20)24(21,22)15-10(2)16-17-11(15)3/h5-8H,4,9H2,1-3H3,(H,16,17)(H,19,20)
InChI key:InChIKey=GORZILZTPWXYJZ-UHFFFAOYSA-N
SMILES:S(N(CC(O)=O)C1=CC=C(OCC)C=C1)(=O)(=O)C=2C(C)=NNC2C
Synonyms:- Glycine, N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-(4-ethoxyphenyl)-
- N-[(3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-(4-ethoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.