CAS 1240256-89-6

(OC-6-21)-(2-Cyanophenyl)pentafluorosulfur

Description:

(OC-6-21)-(2-Cyanophenyl)pentafluorosulfur, identified by its CAS number 1240256-89-6, is a specialized chemical compound notable for its unique structural features and properties. This substance contains a pentafluorosulfur moiety, which contributes to its high electronegativity and potential reactivity, particularly in fluorinated environments. The presence of the 2-cyanophenyl group introduces additional functional characteristics, such as the ability to engage in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's fluorinated nature may enhance its thermal stability and resistance to degradation, making it suitable for applications in advanced materials and pharmaceuticals. Furthermore, its specific molecular structure may impart unique optical or electronic properties, which could be leveraged in specialized applications such as sensors or electronic devices. Overall, (OC-6-21)-(2-Cyanophenyl)pentafluorosulfur exemplifies the complexity and versatility of modern chemical compounds, particularly those incorporating fluorine and cyano functionalities.

Formula: C₇H₄F₅NS

InChI: InChI=1S/C7H4F5NS/c8-14(9,10,11,12)7-4-2-1-3-6(7)5-13/h1-4H

InChI key: InChIKey=HZMOEVCJSPRORJ-UHFFFAOYSA-N

SMILES: C(#N)C1=C(S(F)(F)(F)(F)F)C=CC=C1

Synonyms:

• (OC-6-21)-(2-Cyanophenyl)pentafluorosulfur
• Sulfur, (2-cyanophenyl)pentafluoro-, (OC-6-21)-

2-(Pentafluorothio)benzonitrile

CAS: 1240256-89-6

2-(Pentafluorothio)benzonitrile

Purity: ≥95%

Molecular weight: 229.17g/mol

Ref: 54-PC501443