CAS 1240257-75-3

(OC-6-21)-[3-Chloro-5-(cyanomethyl)phenyl]pentafluorosulfur

Description:

(OC-6-21)-[3-Chloro-5-(cyanomethyl)phenyl]pentafluorosulfur, identified by its CAS number 1240257-75-3, is a synthetic chemical compound characterized by its unique structure that includes a phenyl ring substituted with a chlorine atom and a cyanomethyl group, along with a pentafluorosulfur moiety. The presence of multiple fluorine atoms contributes to its high electronegativity and potential reactivity, making it of interest in various chemical applications, including materials science and pharmaceuticals. The cyanomethyl group introduces a nitrile functionality, which can participate in nucleophilic reactions, while the chlorinated phenyl ring may enhance the compound's stability and solubility in organic solvents. This compound's specific properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the environment in which it is used. Overall, its unique combination of functional groups suggests potential utility in advanced chemical synthesis and as a building block in the development of novel materials.

Formula: C₈H₅ClF₅NS

InChI: InChI=1S/C8H5ClF5NS/c9-7-3-6(1-2-15)4-8(5-7)16(10,11,12,13)14/h3-5H,1H2

InChI key: InChIKey=WTFFVDFJXLCKCQ-UHFFFAOYSA-N

SMILES: S(F)(F)(F)(F)(F)C1=CC(CC#N)=CC(Cl)=C1

Synonyms:

• Sulfur, [3-chloro-5-(cyanomethyl)phenyl]pentafluoro-, (OC-6-21)-
• (OC-6-21)-[3-Chloro-5-(cyanomethyl)phenyl]pentafluorosulfur

3-Chloro-5-(pentafluorosulfur)phenylacetonitrile

CAS: 1240257-75-3

3-Chloro-5-(pentafluorosulfur)phenylacetonitrile

Purity: ≥95%

Molecular weight: 277.64g/mol

Ref: 54-PC302836