CAS 1240257-86-6

(OC-6-21)-[4-(Aminomethyl)-3-fluorophenyl]pentafluorosulfur

Description:

(OC-6-21)-[4-(Aminomethyl)-3-fluorophenyl]pentafluorosulfur, identified by its CAS number 1240257-86-6, is a chemical compound characterized by its unique structure that includes a pentafluorosulfur moiety and an aminomethyl group attached to a fluorinated phenyl ring. The presence of multiple fluorine atoms contributes to its high electronegativity and potential reactivity, making it of interest in various chemical applications, including pharmaceuticals and materials science. The aminomethyl group may impart basic properties, allowing for interactions with other chemical species. This compound's fluorinated nature can enhance its stability and lipophilicity, which are critical factors in drug design and development. Additionally, the specific arrangement of functional groups can influence its biological activity and solubility. Overall, this compound exemplifies the complexity and versatility of fluorinated organic compounds in modern chemistry.

Formula: C₇H₇F₆NS

InChI: InChI=1S/C7H7F6NS/c8-7-3-6(2-1-5(7)4-14)15(9,10,11,12)13/h1-3H,4,14H2

InChI key: InChIKey=YVTBXCFUDHLPBW-UHFFFAOYSA-N

SMILES: S(F)(F)(F)(F)(F)C1=CC(F)=C(CN)C=C1

Synonyms:

• (OC-6-21)-[4-(Aminomethyl)-3-fluorophenyl]pentafluorosulfur
• Sulfur, [4-(aminomethyl)-3-fluorophenyl]pentafluoro-, (OC-6-21)-
• (2-Fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl)methanamine
• 2-Fluoro-4-(pentafluorosulfur)benzylamine

2-Fluoro-4-(pentafluorosulfur)benzylamine

CAS: 1240257-86-6

2-Fluoro-4-(pentafluorosulfur)benzylamine

Formula: C₇H₇F₆NS

Purity: 97%

Color and Shape: clear. faint yellow liquid

Molecular weight: 251.19259g/mol

Ref: 54-PC302239

2-Fluoro-4-(pentafluorosulfur)benzylamine

CAS: 1240257-86-6

Formula: C₇H₇F₆NS

Molecular weight: 251.19

Ref: 10-F343165