CAS 124027-47-0

1-Acridinol,9-amino-1,2,3,4-tetrahydro-

Description:

1-Acridinol, 9-amino-1,2,3,4-tetrahydro- is a chemical compound characterized by its structure, which includes an acridine core modified with a hydroxyl group and an amino group. This compound is part of a class of heterocyclic organic compounds known for their diverse biological activities. The presence of the hydroxyl (-OH) and amino (-NH2) functional groups suggests potential for hydrogen bonding, which can influence its solubility and reactivity. Typically, such compounds may exhibit properties like antimicrobial, antitumor, or anti-inflammatory activities, making them of interest in medicinal chemistry. The tetrahydro configuration indicates that the compound is saturated, which can affect its stability and interaction with biological targets. Additionally, the molecular weight and specific stereochemistry can play crucial roles in determining its pharmacokinetic and pharmacodynamic profiles. Overall, 1-Acridinol, 9-amino-1,2,3,4-tetrahydro- represents a unique structure that may have significant implications in pharmaceutical research and development.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1S/C13H14N2O/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13/h1-2,4-5,11,16H,3,6-7H2,(H2,14,15)

InChI key: InChIKey=HLVVITIHAZBPKB-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=3C1=CC=CC3)CCCC2O

Synonyms:

• (?à)-9-Amino-1,2,3,4-tetrahydroacridin-1-ol
• 1-Hydroxytacrine
• 9-Amino-1,2,3,4-tetrahydro-1-acridinol
• 9-Amino-1,2,3,4-tetrahydroacridin-1-ol
• Hydroxytacrine
• Velnacrine

1-Acridinol, 9-amino-1,2,3,4-tetrahydro-

CAS: 124027-47-0

Formula: C₁₃H₁₄N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.2631

Ref: IN-DA000LFB

Velnacrine

CAS: 124027-47-0

Velnacrine

Purity: ≥98%

Molecular weight: 214.26g/mol

Ref: 54-BUP20913

1-Hydroxy Tacrine

CAS: 124027-47-0

Formula: C₁₃H₁₄N₂O

Color and Shape: Pale Yellow Solid

Molecular weight: 214.27

Ref: 4Z-T-272

Velnacrine

CAS: 124027-47-0

Velnacrine (1,2,3,4-tetrahydro-9-aminoacridin-1-ol maleate) is a biochemical.

Formula: C₁₃H₁₄N₂O

Purity: 99.83%

Color and Shape: Solid

Molecular weight: 214.26

Ref: TM-T35045

Velnacrine

CAS: 124027-47-0

Purity: 95.0%

Molecular weight: 214.26800537109375

Ref: 10-F462711

Velnacrine

CAS: 124027-47-0

Velnacrine is a reversible monoamine oxidase B (MAO-B) inhibitor, which is a synthetic compound derived from acridine. Its mode of action involves inhibiting the enzyme MAO-B, which is responsible for the breakdown of monoamines in the central nervous system. This inhibition leads to increased levels of monoamines, such as dopamine, which are crucial for cognitive and motor function.

Formula: C₁₃H₁₄N₂O

Purity: Min. 95%

Molecular weight: 214.26 g/mol

Ref: 3D-ZEA02747