CAS 124027-58-3
:Kobophenol A
Description:
Kobophenol A, with the CAS number 124027-58-3, is a chemical compound known for its antioxidant properties. It is a polyphenolic compound that is derived from natural sources, particularly from certain plant extracts. Kobophenol A exhibits a strong ability to scavenge free radicals, which makes it of interest in various applications, including cosmetics and food preservation, where it can help prevent oxidative damage. The compound is characterized by its phenolic structure, which contributes to its reactivity and biological activity. Additionally, Kobophenol A has been studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. Its solubility in organic solvents and moderate stability under various conditions make it suitable for formulation in different products. However, as with many chemical substances, the specific safety profile and regulatory status should be considered when evaluating its use in consumer products. Overall, Kobophenol A represents a valuable compound in the field of natural antioxidants and functional ingredients.
Formula:C56H44O13
InChI:InChI=1S/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56-/m1/s1
InChI key:InChIKey=RAUCCLKIJHMTND-LUPMIFTGSA-N
SMILES:OC1=CC([C@H]2C3=C(C=C(O)C=C3O[C@@H]2C4=CC=C(O)C=C4)[C@@H]5[C@@H]([C@H](O[C@@H]5C6=CC=C(O)C=C6)C7=CC=C(O)C=C7)C8=CC(O)=CC(O)=C8)=C9[C@H]([C@@H](OC9=C1)C%10=CC=C(O)C=C%10)C%11=CC(O)=CC(O)=C%11
Synonyms:- (2S,2′R,3S,3′R)-3′-(3,5-Dihydroxyphenyl)-4-[(2S,3S,4R,5S)-4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)[3,4′-bibenzofuran]-6,6′-diol
- Kobophenol A
- [3,4'-Bibenzofuran]-6,6'-diol,3'-(3,5-dihydroxyphenyl)-4-[4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2',3,3'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-,[2S-[2a,3a[2R*,3R*(2'S*,3'S*)],4a,5b]]-
- [3,4′-Bibenzofuran]-6,6′-diol, 3′-(3,5-dihydroxyphenyl)-4-[(2S,3S,4R,5S)-4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)-, (2S,2′R,3S,3′R)-
- [3,4′-Bibenzofuran]-6,6′-diol, 3′-(3,5-dihydroxyphenyl)-4-[4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)-, [2S-[2α,3α[2R*,3R*(2′S*,3′S*)],4α,5β]]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Kobophenol A
CAS:Kobophenol A: antimicrobial, anti-inflammatory, may treat bone disease, inhibits AChE (IC50=115.8mM), protects SH-SY5Y cells from oxidative damage.Formula:C56H44O13Purity:98%Color and Shape:SolidMolecular weight:924.94Kobophenol A
CAS:Kobophenol A is a natural compound, which is a polyphenolic stilbene tetramer derived from plants such as Caragana and Rheum species. It exhibits a rich source of bioactive compound due to its complex structure and multiple hydroxyl groups, contributing to antioxidant, anti-inflammatory, and potential anti-cancer properties. The compound operates by modulating various biochemical pathways, including inhibiting key enzymes and signaling cascades related to oxidative stress and inflammation.Formula:C56H44O13Purity:Min. 95%Molecular weight:924.90 g/mol


