CymitQuimica logo

CAS 1240490-25-8

:

Carbamic acid, N-[(1R)-2-hydroxy-1-methylethyl]-, 2-propen-1-yl ester

Description:
Carbamic acid, N-[(1R)-2-hydroxy-1-methylethyl]-, 2-propen-1-yl ester, identified by CAS number 1240490-25-8, is an organic compound characterized by its carbamate functional group. This compound features a chiral center, which contributes to its stereochemistry, specifically the (1R) configuration. The presence of a hydroxy group and a propenyl ester moiety indicates that it may exhibit unique reactivity and solubility properties, potentially making it useful in various chemical applications, including as an intermediate in organic synthesis or in agrochemical formulations. The compound's structure suggests it may participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties such as boiling point and solubility in polar solvents. Additionally, the propenyl group may allow for further chemical modifications, enhancing its versatility in synthetic pathways. As with many carbamates, it is essential to consider its potential biological activity and environmental impact, particularly in terms of toxicity and degradation.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-3-4-11-7(10)8-6(2)5-9/h3,6,9H,1,4-5H2,2H3,(H,8,10)/t6-/m1/s1
InChI key:IJKYPCMXKJUEIW-ZCFIWIBFSA-N
SMILES:C[C@H](CO)NC(=O)OCC=C
Synonyms:
  • N-Allyloxycarbonyl-(R)-2-aminopropan-1-ol
Found 2 products.