
CAS 124050-15-3
:2-(Chloromethyl)-6-fluoroquinoline
Description:
2-(Chloromethyl)-6-fluoroquinoline is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a nitrogen atom in its aromatic ring. This compound features a chloromethyl group (-CH2Cl) at the second position and a fluorine atom at the sixth position of the quinoline ring, which contributes to its unique reactivity and potential applications. The presence of these substituents can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity towards nucleophiles. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the chloromethyl group can serve as a reactive site for further chemical modifications, allowing for the synthesis of more complex derivatives. Safety and handling precautions are essential when working with this compound, as halogenated organic compounds can pose health risks and environmental concerns.
Formula:C10H7ClFN
InChI:InChI=1S/C10H7ClFN/c11-6-9-3-1-7-5-8(12)2-4-10(7)13-9/h1-5H,6H2
InChI key:InChIKey=TYLAXVCCIGSMHK-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC2=C(C=C(F)C=C2)C=C1
Synonyms:- 6-Fluoro-2-chloromethylquinoline
- 6-Fluoro-2-quinolylmethyl chloride
- 2-(Chloromethyl)-6-fluoroquinoline
- 2-Chloromethyl-6-fluoroquinoline
- Quinoline, 2-(chloromethyl)-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
