CymitQuimica logo

CAS 1240518-42-6

:

6-Fluoro-4-methoxy-1H-indazol-3-amine

Description:
6-Fluoro-4-methoxy-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a fluorine atom at the 6-position and a methoxy group at the 4-position contributes to its unique chemical properties and potential biological activity. This compound is typically classified as an aromatic amine due to the amine functional group attached to the indazole ring. It may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the indazole ring, affecting its behavior in different chemical environments. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C8H8FN3O
InChI:InChI=1S/C8H8FN3O/c1-13-6-3-4(9)2-5-7(6)8(10)12-11-5/h2-3H,1H3,(H3,10,11,12)
InChI key:InChIKey=QVFSZQBFFBLSJP-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NN=C2N)=CC(F)=C1
Synonyms:
  • 6-Fluoro-4-methoxy-1H-indazol-3-amine
  • 1H-Indazol-3-amine, 6-fluoro-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.