
CAS 1240525-77-2
:3-(Phenylmethyl)-3-azabicyclo[3.1.1]heptan-6-ol
Description:
3-(Phenylmethyl)-3-azabicyclo[3.1.1]heptan-6-ol, identified by its CAS number 1240525-77-2, is a bicyclic compound featuring a nitrogen atom within its structure, which classifies it as a bicyclic amine. This compound exhibits a unique bicyclo[3.1.1] framework, characterized by its two bridged carbon atoms and a nitrogen atom, contributing to its potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The hydroxyl (-OH) group at the 6-position adds to its polarity and can participate in hydrogen bonding, affecting its solubility and reactivity. Such structural features suggest that this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Its specific stereochemistry and functional groups could also play a significant role in determining its pharmacokinetic and pharmacodynamic properties. Further studies would be necessary to fully elucidate its biological effects and potential therapeutic uses.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c15-13-11-6-12(13)9-14(8-11)7-10-4-2-1-3-5-10/h1-5,11-13,15H,6-9H2
InChI key:InChIKey=NERPUNDHAOPKPP-UHFFFAOYSA-N
SMILES:OC1C2CC1CN(CC3=CC=CC=C3)C2
Synonyms:- 3-Azabicyclo[3.1.1]heptan-6-ol, 3-(phenylmethyl)-
- 3-(Phenylmethyl)-3-azabicyclo[3.1.1]heptan-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.