
CAS 1240525-82-9
:3-Azabicyclo[3.1.1]heptan-6-ol, 6-(trifluoromethyl)-
Description:
3-Azabicyclo[3.1.1]heptan-6-ol, 6-(trifluoromethyl)- is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom in the ring system, making it a nitrogen-containing heterocycle. The presence of a hydroxyl group (-OH) at the 6-position contributes to its potential as an alcohol, influencing its solubility and reactivity. The trifluoromethyl group (-CF3) at the same position enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. This compound may exhibit interesting pharmacological properties due to its structural features, which can influence interactions with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and materials science. As with many fluorinated compounds, it is essential to consider environmental and safety aspects during handling and disposal.
Formula:C7H10F3NO
InChI:InChI=1S/C7H10F3NO/c8-7(9,10)6(12)4-1-5(6)3-11-2-4/h4-5,11-12H,1-3H2
InChI key:InChIKey=KCXJTFQFEKXYHG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)C2CC1CNC2
Synonyms:- 6-(Trifluoromethyl)-3-azabicyclo[3.1.1]heptan-6-ol
- 3-Azabicyclo[3.1.1]heptan-6-ol, 6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.