CymitQuimica logo

CAS 1240526-09-3

:

α-Azido-4-fluorobenzeneacetamide

Description:
α-Azido-4-fluorobenzeneacetamide is a chemical compound characterized by the presence of an azido group (-N3) and a fluorobenzene moiety, specifically with a fluorine atom positioned at the para position relative to the acetamide group. This compound typically exhibits properties associated with both azides and aromatic amides, including potential reactivity due to the azido group, which can participate in various chemical reactions such as nucleophilic substitutions or cycloadditions. The fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity and solubility in organic solvents. The presence of the acetamide functional group suggests that the compound may exhibit hydrogen bonding capabilities, affecting its physical properties such as melting point and solubility. Overall, α-Azido-4-fluorobenzeneacetamide is of interest in synthetic organic chemistry and may have applications in medicinal chemistry or materials science due to its unique structural features.
Formula:C8H7FN4O
InChI:InChI=1S/C8H7FN4O/c9-6-3-1-5(2-4-6)7(8(10)14)12-13-11/h1-4,7H,(H2,10,14)
InChI key:InChIKey=LXKXXGYSFCHZKA-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])(C(N)=O)C1=CC=C(F)C=C1
Synonyms:
  • α-Azido-4-fluorobenzeneacetamide
  • Benzeneacetamide, α-azido-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.