CAS 1240526-11-7

Acetamide, 2-amino-N-1-naphthalenyl-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-1-naphthalenyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a naphthalene moiety, which contributes to its aromatic properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The compound features a primary amine, which can participate in hydrogen bonding, enhancing its solubility and reactivity. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The presence of the naphthalene ring may also impart unique electronic properties, making it of interest in organic synthesis and materials science. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper precautions are taken. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₂N₂O·ClH

InChI: InChI=1S/C12H12N2O.ClH/c13-8-12(15)14-11-7-3-5-9-4-1-2-6-10(9)11;/h1-7H,8,13H2,(H,14,15);1H

InChI key: InChIKey=DGUKPHFAODEZAU-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C=1C2=C(C=CC1)C=CC=C2.Cl

Synonyms:

• Acetamide, 2-amino-N-1-naphthalenyl-, hydrochloride (1:1)

2-Amino-N-(naphthalen-1-yl)acetamide hydrochloride

CAS: 1240526-11-7

Versatile small molecule scaffold

Formula: C₁₂H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 236.7 g/mol

Ref: 3D-QZB52611