CAS 1240526-12-8

Ethanamine, 2,2-difluoro-N-(2-methoxyethyl)-, hydrochloride (1:1)

Description:

Ethanamine, 2,2-difluoro-N-(2-methoxyethyl)-, hydrochloride (1:1), with the CAS number 1240526-12-8, is a chemical compound characterized by its amine functional group and the presence of two fluorine atoms on the ethyl side chain. This compound is a hydrochloride salt, indicating that it is typically encountered in a protonated form, which enhances its solubility in water and other polar solvents. The methoxyethyl substituent contributes to its potential applications in medicinal chemistry, as it may influence the compound's pharmacokinetic properties, such as absorption and distribution. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it of interest in drug design. Additionally, the compound's structure suggests potential reactivity typical of amines, including nucleophilic substitution reactions. Overall, this compound's unique characteristics may render it useful in various chemical and pharmaceutical applications, although specific biological activity and safety profiles would require further investigation.

Formula: C₅H₁₁F₂NO·ClH

InChI: InChI=1S/C5H11F2NO.ClH/c1-9-3-2-8-4-5(6)7;/h5,8H,2-4H2,1H3;1H

InChI key: InChIKey=ALDZFQLZDYAAJH-UHFFFAOYSA-N

SMILES: N(CC(F)F)CCOC.Cl

Synonyms:

• (2,2-Difluoroethyl)(2-methoxyethyl)amine hydrochloride
• Ethanamine, 2,2-difluoro-N-(2-methoxyethyl)-, hydrochloride (1:1)

(2,2-Difluoroethyl)(2-methoxyethyl)amine hydrochloride

CAS: 1240526-12-8

Versatile small molecule scaffold

Formula: C₅H₁₂ClF₂NO

Purity: Min. 95%

Molecular weight: 175.6 g/mol

Ref: 3D-QZB52612