CAS 1240526-13-9

Propanoic acid, 3-[(2-ethoxyethyl)amino]-2-methyl-, hydrochloride (1:1)

Description:

Propanoic acid, 3-[(2-ethoxyethyl)amino]-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a propanoic acid moiety and an ethoxyethyl amino group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the amino group suggests potential basic properties, while the propanoic acid component contributes to its acidic characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical applications. Its molecular structure allows for interactions with biological systems, potentially influencing its pharmacokinetics and pharmacodynamics. As with many hydrochloride salts, it is likely to be stable under standard conditions but should be handled with care, following appropriate safety protocols due to its acidic nature. Overall, this compound's unique combination of functional groups may confer specific reactivity and utility in various chemical and biological contexts.

Formula: C₈H₁₇NO₃·ClH

InChI: InChI=1S/C8H17NO3.ClH/c1-3-12-5-4-9-6-7(2)8(10)11;/h7,9H,3-6H2,1-2H3,(H,10,11);1H

InChI key: InChIKey=DOYAWJUPMZNNFK-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)C)NCCOCC.Cl

Synonyms:

• Propanoic acid, 3-[(2-ethoxyethyl)amino]-2-methyl-, hydrochloride (1:1)

3-[(2-Ethoxyethyl)amino]-2-methylpropanoic acid hydrochloride

CAS: 1240526-13-9

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 211.68 g/mol

Ref: 3D-QZB52613